What is the PubChem CID of 2-Propylcyclohexanone?
The PubChem CID of 2-Propylcyclohexanone is 7199.
What is the molecular formula of 2-Propylcyclohexanone?
The molecular formula of 2-Propylcyclohexanone is C9H16O.
What is the synonyms of 2-Propylcyclohexanone?
The synonyms of 2-Propylcyclohexanone are 2-PROPYLCYCLOHEXANONE, Cyclohexanone, 2-propyl-, and 2-propylcyclohexan-1-one.
What is the molecular weight of 2-Propylcyclohexanone?
The molecular weight of 2-Propylcyclohexanone is 140.22 g/mol.
What is the IUPAC name of 2-Propylcyclohexanone?
The IUPAC name of 2-Propylcyclohexanone is 2-propylcyclohexan-1-one.
What is the InChI of 2-Propylcyclohexanone?
The InChI of 2-Propylcyclohexanone is InChI=1S/C9H16O/c1-2-5-8-6-3-4-7-9(8)10/h8H,2-7H2,1H3.
What is the InChIKey of 2-Propylcyclohexanone?
The InChIKey of 2-Propylcyclohexanone is OCJLPZCBZSCVCO-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Propylcyclohexanone?
The canonical SMILES of 2-Propylcyclohexanone is CCCC1CCCCC1=O.
What is the CAS number of 2-Propylcyclohexanone?
The CAS number of 2-Propylcyclohexanone is 94-65-5.
Is 2-Propylcyclohexanone a covalently-bonded unit?
Yes, 2-Propylcyclohexanone is a covalently-bonded unit.