What is the molecular formula of 3-Fluoro-4-nitro-phenol?
The molecular formula of 3-Fluoro-4-nitro-phenol is C6H4FNO3.
What is the molecular weight of 3-Fluoro-4-nitro-phenol?
The molecular weight of 3-Fluoro-4-nitro-phenol is 157.10 g/mol.
What is the IUPAC name of 3-Fluoro-4-nitro-phenol?
The IUPAC name of 3-Fluoro-4-nitro-phenol is 3-fluoro-4-nitrophenol.
What is the InChI of 3-Fluoro-4-nitro-phenol?
The InChI of 3-Fluoro-4-nitro-phenol is InChI=1S/C6H4FNO3/c7-5-3-4(9)1-2-6(5)8(10)11/h1-3,9H.
What is the InChIKey of 3-Fluoro-4-nitro-phenol?
The InChIKey of 3-Fluoro-4-nitro-phenol is CSSGKHVRDGATJL-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Fluoro-4-nitro-phenol?
The Canonical SMILES of 3-Fluoro-4-nitro-phenol is C1=CC(=C(C=C1O)F)[N+](=O)[O-].
What is the CAS number of 3-Fluoro-4-nitro-phenol?
The CAS number of 3-Fluoro-4-nitro-phenol is 394-41-2.
What is the EC number of 3-Fluoro-4-nitro-phenol?
The EC number of 3-Fluoro-4-nitro-phenol is 206-895-6.
Is 3-Fluoro-4-nitro-phenol a canonicalized compound?
Yes, 3-Fluoro-4-nitro-phenol is a canonicalized compound.