What is the molecular formula of butyl p-hydroxy benzoate?
The molecular formula of butyl p-hydroxy benzoate is C11H14O3.
What is the molecular weight of butyl p-hydroxy benzoate?
The molecular weight of butyl p-hydroxy benzoate is 194.23 g/mol.
What are some synonyms for butyl p-hydroxy benzoate?
Some synonyms for butyl p-hydroxy benzoate are BUTYLPARABEN, Butyl 4-hydroxybenzoate, Butyl paraben, and Butyl p-hydroxybenzoate.
What is the IUPAC name of butyl p-hydroxy benzoate?
The IUPAC name of butyl p-hydroxy benzoate is butyl 4-hydroxybenzoate.
What is the InChI of butyl p-hydroxy benzoate?
The InChI of butyl p-hydroxy benzoate is InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H3.
What is the InChIKey of butyl p-hydroxy benzoate?
The InChIKey of butyl p-hydroxy benzoate is QFOHBWFCKVYLES-UHFFFAOYSA-N.
What is the Canonical SMILES of butyl p-hydroxy benzoate?
The Canonical SMILES of butyl p-hydroxy benzoate is CCCCOC(=O)C1=CC=C(C=C1)O.
What is the CAS number of butyl p-hydroxy benzoate?
The CAS number of butyl p-hydroxy benzoate is 94-26-8.
What is the FEMA number of butyl p-hydroxy benzoate?
The FEMA number of butyl p-hydroxy benzoate is 2203.
What is the molecular weight of butyl p-hydroxy benzoate according to PubChem?
The molecular weight of butyl p-hydroxy benzoate is 194.23 g/mol, computed by PubChem 2.2.