What is the molecular formula of 4-Chlorobenzoic acid?
The molecular formula of 4-Chlorobenzoic acid is C7H5ClO2.
What is the molecular weight of 4-Chlorobenzoic acid?
The molecular weight of 4-Chlorobenzoic acid is 156.56 g/mol.
What is the IUPAC name of 4-Chlorobenzoic acid?
The IUPAC name of 4-Chlorobenzoic acid is 4-chlorobenzoic acid.
What is the InChI of 4-Chlorobenzoic acid?
The InChI of 4-Chlorobenzoic acid is InChI=1S/C7H5ClO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10).
What is the InChIKey of 4-Chlorobenzoic acid?
The InChIKey of 4-Chlorobenzoic acid is XRHGYUZYPHTUJZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chlorobenzoic acid?
The canonical SMILES of 4-Chlorobenzoic acid is C1=CC(=CC=C1C(=O)O)Cl.
What is the CAS number of 4-Chlorobenzoic acid?
The CAS number of 4-Chlorobenzoic acid is 74-11-3.
What is the EC number of 4-Chlorobenzoic acid?
The EC number of 4-Chlorobenzoic acid is 200-805-9.
What is the UNII of 4-Chlorobenzoic acid?
The UNII of 4-Chlorobenzoic acid is IC7888DF4L.
What is the XLogP3 value of 4-Chlorobenzoic acid?
The XLogP3 value of 4-Chlorobenzoic acid is 2.7.