What is the molecular formula of Ethyl 4-methylbenzoate?
The molecular formula of Ethyl 4-methylbenzoate is C10H12O2.
What is the molecular weight of Ethyl 4-methylbenzoate?
The molecular weight of Ethyl 4-methylbenzoate is 164.20 g/mol.
What is the IUPAC Name of Ethyl 4-methylbenzoate?
The IUPAC Name of Ethyl 4-methylbenzoate is ethyl 4-methylbenzoate.
What is the InChI of Ethyl 4-methylbenzoate?
The InChI of Ethyl 4-methylbenzoate is InChI=1S/C10H12O2/c1-3-12-10(11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3.
What is the InChIKey of Ethyl 4-methylbenzoate?
The InChIKey of Ethyl 4-methylbenzoate is NWPWRAWAUYIELB-UHFFFAOYSA-N.
What is the CAS number of Ethyl 4-methylbenzoate?
The CAS number of Ethyl 4-methylbenzoate is 94-08-6.
What is the XLogP3 of Ethyl 4-methylbenzoate?
The XLogP3 of Ethyl 4-methylbenzoate is 2.9.
How many hydrogen bond donor counts does Ethyl 4-methylbenzoate have?
Ethyl 4-methylbenzoate has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does Ethyl 4-methylbenzoate have?
Ethyl 4-methylbenzoate has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does Ethyl 4-methylbenzoate have?
Ethyl 4-methylbenzoate has 3 rotatable bond counts.
Download
![5-[(Methylthio)methyl]-2-furoic acid](https://resource.alfa-chemistry.com/structure/94084-70-5.gif)
![Lithium 3-[[(2-hydroxyethyl)amino]carbonyl]pentadecenoate](https://resource.alfa-chemistry.com/structure/94086-41-6.gif)
