What is the molecular formula of ethyl benzoylacetate?
The molecular formula of ethyl benzoylacetate is C11H12O3.
What are the synonyms of ethyl benzoylacetate?
The synonyms of ethyl benzoylacetate are ETHYL BENZOYLACETATE, Ethyl 3-oxo-3-phenylpropanoate, 94-02-0, Ethyl benzoyl acetate, and Benzoylacetic acid ethyl ester.
What is the molecular weight of ethyl benzoylacetate?
The molecular weight of ethyl benzoylacetate is 192.21 g/mol.
What is the IUPAC name of ethyl benzoylacetate?
The IUPAC name of ethyl benzoylacetate is ethyl 3-oxo-3-phenylpropanoate.
What is the InChI of ethyl benzoylacetate?
The InChI of ethyl benzoylacetate is InChI=1S/C11H12O3/c1-2-14-11(13)8-10(12)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3.
What is the InChIKey of ethyl benzoylacetate?
The InChIKey of ethyl benzoylacetate is GKKZMYDNDDMXSE-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl benzoylacetate?
The canonical SMILES of ethyl benzoylacetate is CCOC(=O)CC(=O)C1=CC=CC=C1.
What is the CAS number of ethyl benzoylacetate?
The CAS number of ethyl benzoylacetate is 94-02-0.
What is the European Community (EC) number of ethyl benzoylacetate?
The European Community (EC) number of ethyl benzoylacetate is 202-295-3.
What is the FEMA number of ethyl benzoylacetate?
The FEMA number of ethyl benzoylacetate is 2423.
Download
![7-Amino-4-hydroxy-3-[[6(or 7)-sulfo-4-[[4-[(3-sulfophenyl)azo]-1-naphthyl]azo]-1-naphthyl]azo]naphthalene-2-sulfonic](https://resource.alfa-chemistry.com/structure/94020-85-6.gif)
