What is the molecular formula of ammonium pentyl sulfate?
The molecular formula of ammonium pentyl sulfate is C5H15NO4S.
What is the molecular weight of ammonium pentyl sulfate?
The molecular weight of ammonium pentyl sulfate is 185.24 g/mol.
What is the IUPAC name of ammonium pentyl sulfate?
The IUPAC name of ammonium pentyl sulfate is azanium;pentyl sulfate.
What is the InChI of ammonium pentyl sulfate?
The InChI of ammonium pentyl sulfate is InChI=1S/C5H12O4S.H3N/c1-2-3-4-5-9-10(6,7)8;/h2-5H2,1H3,(H,6,7,8);1H3.
What is the InChIKey of ammonium pentyl sulfate?
The InChIKey of ammonium pentyl sulfate is MGHQUGUIYCOZKR-UHFFFAOYSA-N.
What is the canonical SMILES of ammonium pentyl sulfate?
The canonical SMILES of ammonium pentyl sulfate is CCCCCOS(=O)(=O)[O-].[NH4+].
What is the CAS number of ammonium pentyl sulfate?
The CAS number of ammonium pentyl sulfate is 93982-33-3.
What is the European Community (EC) number of ammonium pentyl sulfate?
The European Community (EC) number of ammonium pentyl sulfate is 301-222-3.
What is the UNII of ammonium pentyl sulfate?
The UNII of ammonium pentyl sulfate is 5RC36QJU2M.
Is the compound canonicalized?
Yes, the compound is canonicalized.