What is the IUPAC name of Cycloocten-1-yl acetate?
The IUPAC name of Cycloocten-1-yl acetate is [(1E)-cycloocten-1-yl] acetate.
What is the molecular formula of Cycloocten-1-yl acetate?
The molecular formula of Cycloocten-1-yl acetate is C10H16O2.
What is the molecular weight of Cycloocten-1-yl acetate?
The molecular weight of Cycloocten-1-yl acetate is 168.23 g/mol.
What is the InChI of Cycloocten-1-yl acetate?
The InChI of Cycloocten-1-yl acetate is InChI=1S/C10H16O2/c1-9(11)12-10-7-5-3-2-4-6-8-10/h7H,2-6,8H2,1H3/b10-7+.
What is the InChIKey of Cycloocten-1-yl acetate?
The InChIKey of Cycloocten-1-yl acetate is GCKRQQJBNDAYRT-JXMROGBWSA-N.
What is the canonical SMILES of Cycloocten-1-yl acetate?
The canonical SMILES of Cycloocten-1-yl acetate is CC(=O)OC1=CCCCCCC1.
How many hydrogen bond donor counts does Cycloocten-1-yl acetate have?
Cycloocten-1-yl acetate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Cycloocten-1-yl acetate have?
Cycloocten-1-yl acetate has 2 hydrogen bond acceptor counts.
How many rotatable bond counts does Cycloocten-1-yl acetate have?
Cycloocten-1-yl acetate has 2 rotatable bond counts.
Is Cycloocten-1-yl acetate a canonicalized compound?
Yes, Cycloocten-1-yl acetate is a canonicalized compound.
Download
![[2-[[2-Cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]ethyl](3-hydroxypropyl)dimethylammonium chloride](https://resource.alfa-chemistry.com/structure/93981-79-4.gif)
![Benzene,[2,2-bis(isotridecyloxy)ethyl]-(9ci)](https://resource.alfa-chemistry.com/structure/93981-84-1.gif)
![[2-(Acetoxy)ethyl]-3-[[2-cyano-3-[4-(diethylamino)phenyl]-1-oxoallyl]oxy]propyldimethylammonium chloride](https://resource.alfa-chemistry.com/structure/93981-89-6.gif)
