What is the molecular formula of N-Butyryl mesalazine?
The molecular formula of N-Butyryl mesalazine is C11H13NO4.
When was N-Butyryl mesalazine created according to PubChem?
N-Butyryl mesalazine was created on February 29, 2008.
What is the molecular weight of N-Butyryl mesalazine?
The molecular weight of N-Butyryl mesalazine is 223.22 g/mol.
How is the IUPAC name of N-Butyryl mesalazine computed?
The IUPAC name of N-Butyryl mesalazine is computed by Lexichem TK 2.7.0.
What is the Canonical SMILES of N-Butyryl mesalazine?
The Canonical SMILES of N-Butyryl mesalazine is CCCC(=O)NC1=CC(=C(C=C1)O)C(=O)O.
What is the InChIKey of N-Butyryl mesalazine?
The InChIKey of N-Butyryl mesalazine is WVUWWPZYZLFNQU-UHFFFAOYSA-N.
How many hydrogen bond donor counts does N-Butyryl mesalazine have?
N-Butyryl mesalazine has 3 hydrogen bond donor counts.
What is the topological polar surface area of N-Butyryl mesalazine?
The topological polar surface area of N-Butyryl mesalazine is 86.6 Ų.
Does N-Butyryl mesalazine have defined atom stereocenter count?
No, N-Butyryl mesalazine does not have defined atom stereocenter count.
Is N-Butyryl mesalazine canonicalized?
Yes, N-Butyryl mesalazine is canonicalized according to PubChem.