What is the molecular formula of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The molecular formula is C18H32LiNO4.
When was Lithium 1-(2-aminoethyl)2-dodecenylsuccinate created?
It was created on February 5, 2008.
What is the molecular weight of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The molecular weight is 333.4 g/mol.
What is the IUPAC name of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The IUPAC name is lithium;(E)-3-(2-aminoethoxycarbonyl)pentadec-5-enoate.
What is the InChI of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The InChI is InChI=1S/C18H33NO4.Li/c1-2-3-4-5-6-7-8-9-10-11-12-16(15-17(20)21)18(22)23-14-13-19;/h10-11,16H,2-9,12-15,19H2,1H3,(H,20,21);/q;+1/p-1/b11-10+;
What is the Canonical SMILES of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The Canonical SMILES is [Li+].CCCCCCCCCC=CCC(CC(=O)[O-])C(=O)OCCN.
What is the CAS number of Lithium 1-(2-aminoethyl)2-dodecenylsuccinate?
The CAS number is 93964-35-3.
How many hydrogen bond acceptor count does Lithium 1-(2-aminoethyl)2-dodecenylsuccinate have?
It has 5 hydrogen bond acceptor counts.
How many rotatable bond count does Lithium 1-(2-aminoethyl)2-dodecenylsuccinate have?
It has 16 rotatable bond counts.
Is Lithium 1-(2-aminoethyl)2-dodecenylsuccinate a canonicalized compound?
Yes, it is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.