What is the molecular formula of Sorbitan, monoacetate?
The molecular formula of Sorbitan, monoacetate is C8H14O6.
What is the molecular weight of Sorbitan, monoacetate?
The molecular weight of Sorbitan, monoacetate is 206.19 g/mol.
What is the IUPAC name of Sorbitan, monoacetate?
The IUPAC name of Sorbitan, monoacetate is [(1R)-1-[(2S,3R,4S)-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl] acetate.
What is the InChIKey of Sorbitan, monoacetate?
The InChIKey of Sorbitan, monoacetate is MLGREEGGYIPMSP-LXGUWJNJSA-N.
What is the Canonical SMILES of Sorbitan, monoacetate?
The Canonical SMILES of Sorbitan, monoacetate is CC(=O)OC(CO)C1C(C(CO1)O)O.
What is the European Community (EC) Number of Sorbitan, monoacetate?
The European Community (EC) Number of Sorbitan, monoacetate is 300-842-1.
What is the XLogP3-AA value of Sorbitan, monoacetate?
The XLogP3-AA value of Sorbitan, monoacetate is -2.
How many hydrogen bond acceptors are there in Sorbitan, monoacetate?
There are 6 hydrogen bond acceptors in Sorbitan, monoacetate.
What is the topological polar surface area of Sorbitan, monoacetate?
The topological polar surface area of Sorbitan, monoacetate is 96.2 Å2.
Is the compound Canonicalized?
Yes, the compound is Canonicalized.
Download
![Sorbitan,bis(12-hydroxy-9-octadecenoate),[r-[r*,r*-(Z,Z)]]-](https://resource.alfa-chemistry.com/structure/93963-97-4.gif)
![[Mu-[bis(octadecan-1-olato)-mu-oxodioxodiborato(2-)]]bis(nonylphenolato)dicobalt](https://resource.alfa-chemistry.com/structure/93964-01-3.gif)
