What is the molecular formula of Butylpropylthiazole?
The molecular formula of Butylpropylthiazole is C10H17NS.
What is the molecular weight of Butylpropylthiazole?
The molecular weight of Butylpropylthiazole is 183.32 g/mol.
What is the IUPAC name of Butylpropylthiazole?
The IUPAC name of Butylpropylthiazole is 4-butyl-2-propyl-1,3-thiazole.
What is the InChI of Butylpropylthiazole?
The InChI of Butylpropylthiazole is InChI=1S/C10H17NS/c1-3-5-7-9-8-12-10(11-9)6-4-2/h8H,3-7H2,1-2H3.
What is the InChIKey of Butylpropylthiazole?
The InChIKey of Butylpropylthiazole is MXSITAWVUFGESV-UHFFFAOYSA-N.
What is the canonical SMILES of Butylpropylthiazole?
The canonical SMILES of Butylpropylthiazole is CCCCC1=CSC(=N1)CCC.
What is the CAS number of Butylpropylthiazole?
The CAS number of Butylpropylthiazole is 93951-52-1.
What is the EC number of Butylpropylthiazole?
The EC number of Butylpropylthiazole is 300-672-8.
What is the XLogP3-AA value of Butylpropylthiazole?
The XLogP3-AA value of Butylpropylthiazole is 3.9.
Is Butylpropylthiazole a canonicalized compound?
Yes, Butylpropylthiazole is a canonicalized compound.
Download
![Calcium bis[1-methylnaphthalenesulfonate]](https://resource.alfa-chemistry.com/structure/93951-48-5.gif)
![1-Propanone,1-[4(or5)-(2,2-dimethylpropyl)-1-cyclohexen-1-yl]-2-methyl-(9ci)](https://resource.alfa-chemistry.com/structure/93951-51-0.gif)
