What is the molecular formula of Bis-D-menthyl performate?
The molecular formula of Bis-D-menthyl performate is C21H38O3.
What is the molecular weight of Bis-D-menthyl performate?
The molecular weight of Bis-D-menthyl performate is 338.5 g/mol.
What is the IUPAC name of Bis-D-menthyl performate?
The IUPAC name of Bis-D-menthyl performate is bis[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate.
What is the InChI of Bis-D-menthyl performate?
The InChI of Bis-D-menthyl performate is InChI=1S/C21H38O3/c1-13(2)17-9-7-15(5)11-19(17)23-21(22)24-20-12-16(6)8-10-18(20)14(3)4/h13-20H,7-12H2,1-6H3/t15-,16-,17+,18+,19-,20-/m0/s1.
What is the InChIKey of Bis-D-menthyl performate?
The InChIKey of Bis-D-menthyl performate is QFEHNMKROHXPFO-GTYQWKCWSA-N.
What is the canonical SMILES of Bis-D-menthyl performate?
The canonical SMILES of Bis-D-menthyl performate is CC1CCC(C(C1)OC(=O)OC2CC(CCC2C(C)C)C)C(C)C.
What is the isomeric SMILES of Bis-D-menthyl performate?
The isomeric SMILES of Bis-D-menthyl performate is C[C@H]1CC[C@@H]([C@H](C1)OC(=O)O[C@H]2C[C@H](CC[C@@H]2C(C)C)C)C(C)C.
What is the CAS number of Bis-D-menthyl performate?
The CAS number of Bis-D-menthyl performate is 93939-82-3.
What is the European Community (EC) number of Bis-D-menthyl performate?
The European Community (EC) number of Bis-D-menthyl performate is 300-372-7.
Is Bis-D-menthyl performate a canonicalized compound?
Yes, Bis-D-menthyl performate is canonicalized compound according to PubChem.
Download
![Sodium(Z)-alpha-[(3-methoxy-1-methyl-3-oxo-1-propenyl)amino]cyclohexa-1,4-diene-1-acetate](https://resource.alfa-chemistry.com/structure/93939-79-8.gif)
![Sodium(E)-alpha-[(3-methoxy-1-methyl-3-oxo-1-propenyl)amino]cyclohexa-1,4-diene-1-acetate](https://resource.alfa-chemistry.com/structure/93939-80-1.gif)
