What is the molecular formula of 6-Methylnon-4-en-3-one?
The molecular formula is C10H18O.
What is the molecular weight of 6-Methylnon-4-en-3-one?
The molecular weight is 154.25 g/mol.
What is the IUPAC name of 6-Methylnon-4-en-3-one?
The IUPAC name is (E)-6-methylnon-4-en-3-one.
What is the InChI of 6-Methylnon-4-en-3-one?
The InChI is InChI=1S/C10H18O/c1-4-6-9(3)7-8-10(11)5-2/h7-9H,4-6H2,1-3H3/b8-7+.
What is the InChIKey of 6-Methylnon-4-en-3-one?
The InChIKey is JBOKYJTTWHKTAU-BQYQJAHWSA-N.
What is the canonical SMILES of 6-Methylnon-4-en-3-one?
The canonical SMILES is CCCC(C)C=CC(=O)CC.
What is the isomeric SMILES of 6-Methylnon-4-en-3-one?
The isomeric SMILES is CCCC(C)/C=C/C(=O)CC.
What is the CAS number of 6-Methylnon-4-en-3-one?
The CAS number is 93919-88-1.
What is the European Community (EC) number of 6-Methylnon-4-en-3-one?
The European Community (EC) number is 300-073-1.
Is 6-Methylnon-4-en-3-one a canonicalized compound?
Yes, 6-Methylnon-4-en-3-one is a canonicalized compound.