What is the PubChem CID of 7-Methyl-4-quinolone?
The PubChem CID of 7-Methyl-4-quinolone is 5744180.
What is the molecular formula of 7-Methyl-4-quinolone?
The molecular formula of 7-Methyl-4-quinolone is C10H9NO.
What is the molecular weight of 7-Methyl-4-quinolone?
The molecular weight of 7-Methyl-4-quinolone is 159.18 g/mol.
What is the IUPAC name of 7-Methyl-4-quinolone?
The IUPAC name of 7-Methyl-4-quinolone is 7-methyl-1H-quinolin-4-one.
What is the InChI of 7-Methyl-4-quinolone?
The InChI of 7-Methyl-4-quinolone is InChI=1S/C10H9NO/c1-7-2-3-8-9(6-7)11-5-4-10(8)12/h2-6H,1H3,(H,11,12).
What is the InChIKey of 7-Methyl-4-quinolone?
The InChIKey of 7-Methyl-4-quinolone is JPVTWKDGBWUNBQ-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Methyl-4-quinolone?
The canonical SMILES of 7-Methyl-4-quinolone is CC1=CC2=C(C=C1)C(=O)C=CN2.
What is the CAS number of 7-Methyl-4-quinolone?
The CAS number of 7-Methyl-4-quinolone is 93919-55-2.
What is the XLogP3 value of 7-Methyl-4-quinolone?
The XLogP3 value of 7-Methyl-4-quinolone is 0.9.
Is 7-Methyl-4-quinolone a canonicalized compound?
Yes, 7-Methyl-4-quinolone is a canonicalized compound.
Download
![N-[4-[2,4-Bis-(tert-butyl)phenoxy]butyl]-2-[2-hydroxy-3,4,6-trimethyl-5-[(phenylsulfonyl)amino]phenyl]acetamide](https://resource.alfa-chemistry.com/structure/93919-52-9.gif)
![3-[[2-[(2-Aminoethyl)amino]ethyl]amino]-2-hydroxypropyl neodecanoate](https://resource.alfa-chemistry.com/structure/93919-60-9.gif)
![3',6'-Dihydroxy-4',5'-diiodo-2',7'-dimethylspiro[isobenzofuran-1(3H),9'-[9h]xanthene]-3-one](https://resource.alfa-chemistry.com/structure/93919-67-6.gif)
![Nonapotassium hydrogen [[(phosphonomethyl)imino]bis[ethane-2,1-diylnitrilobis(methylene)]]tetrakisphosphonate](https://resource.alfa-chemistry.com/structure/93919-68-7.gif)
