What is the molecular formula of H-Val-his-leu-thr-pro-oh?
The molecular formula of H-Val-his-leu-thr-pro-oh is C26H43N7O7.
What are the synonyms for H-Val-his-leu-thr-pro-oh?
The synonyms for H-Val-his-leu-thr-pro-oh include VHLTP, 93913-38-3, and VAL-HIS-LEU-THR-PRO.
What is the molecular weight of H-Val-his-leu-thr-pro-oh?
The molecular weight of H-Val-his-leu-thr-pro-oh is 565.7 g/mol.
What is the IUPAC name for H-Val-his-leu-thr-pro-oh?
The IUPAC name for H-Val-his-leu-thr-pro-oh is (2S)-1-[(2S,3R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxylic acid.
What is the InChI key for H-Val-his-leu-thr-pro-oh?
The InChI key for H-Val-his-leu-thr-pro-oh is BYCSDJAWFOZAFO-WUEZWNDSSA-N.
What is the canonical SMILES representation of H-Val-his-leu-thr-pro-oh?
The canonical SMILES representation of H-Val-his-leu-thr-pro-oh is CC(C)CC(C(=O)NC(C(C)O)C(=O)N1CCCC1C(=O)O)NC(=O)C(CC2=CN=CN2)NC(=O)C(C(C)C)N.
What is the XLogP3-AA value for H-Val-his-leu-thr-pro-oh?
The XLogP3-AA value for H-Val-his-leu-thr-pro-oh is -2.3.
How many hydrogen bond donor counts are there in H-Val-his-leu-thr-pro-oh?
There are 7 hydrogen bond donor counts in H-Val-his-leu-thr-pro-oh.
How many hydrogen bond acceptor counts are there in H-Val-his-leu-thr-pro-oh?
There are 9 hydrogen bond acceptor counts in H-Val-his-leu-thr-pro-oh.
How many rotatable bond counts are there in H-Val-his-leu-thr-pro-oh?
There are 14 rotatable bond counts in H-Val-his-leu-thr-pro-oh.