What is the molecular formula of Cumenedisulfonic acid?
The molecular formula of Cumenedisulfonic acid is C9H12O6S2.
When was Cumenedisulfonic acid created in PubChem?
Cumenedisulfonic acid was created in PubChem on December 5, 2007.
What is the molecular weight of Cumenedisulfonic acid?
The molecular weight of Cumenedisulfonic acid is 280.3 g/mol.
What is the Canonical SMILES representation of Cumenedisulfonic acid?
The Canonical SMILES representation of Cumenedisulfonic acid is CC(C)C1=C(C(=CC=C1)S(=O)(=O)O)S(=O)(=O)O.
What is the CAS number for Cumenedisulfonic acid?
The CAS number for Cumenedisulfonic acid is 93904-94-0.
How many hydrogen bond donor counts does Cumenedisulfonic acid have?
Cumenedisulfonic acid has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of Cumenedisulfonic acid?
The XLogP3-AA value of Cumenedisulfonic acid is 0.5.
What is the Topological Polar Surface Area of Cumenedisulfonic acid?
The Topological Polar Surface Area of Cumenedisulfonic acid is 126 Ų.
Is Cumenedisulfonic acid a canonicalized compound in PubChem?
Yes, Cumenedisulfonic acid is a canonicalized compound in PubChem.
How many rotatable bond counts does Cumenedisulfonic acid have?
Cumenedisulfonic acid has 3 rotatable bond counts.