What is the molecular formula of 2-Acetylbenzimidazole?
The molecular formula of 2-Acetylbenzimidazole is C9H8N2O.
What is the molecular weight of 2-Acetylbenzimidazole?
The molecular weight of 2-Acetylbenzimidazole is 160.17 g/mol.
What is the IUPAC name of 2-Acetylbenzimidazole?
The IUPAC name of 2-Acetylbenzimidazole is 1-(1H-benzimidazol-2-yl)ethanone.
What is the InChI of 2-Acetylbenzimidazole?
The InChI of 2-Acetylbenzimidazole is InChI=1S/C9H8N2O/c1-6(12)9-10-7-4-2-3-5-8(7)11-9/h2-5H,1H3,(H,10,11).
What is the InChIKey of 2-Acetylbenzimidazole?
The InChIKey of 2-Acetylbenzimidazole is UYFMRVDIXXOWLR-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Acetylbenzimidazole?
The canonical SMILES of 2-Acetylbenzimidazole is CC(=O)C1=NC2=CC=CC=C2N1.
What is the CAS number of 2-Acetylbenzimidazole?
The CAS number of 2-Acetylbenzimidazole is 939-70-8.
What is the EC number of 2-Acetylbenzimidazole?
The EC number of 2-Acetylbenzimidazole is 873-886-7.
What is the XLogP3 value of 2-Acetylbenzimidazole?
The XLogP3 value of 2-Acetylbenzimidazole is 1.3.
Is 2-Acetylbenzimidazole a canonicalized compound?
Yes, 2-Acetylbenzimidazole is a canonicalized compound.
Download
