What is the molecular formula of 1-Propenyl-(4-hydroxyphenyl)ketone?
The molecular formula of 1-Propenyl-(4-hydroxyphenyl)ketone is C19H18O3.
What is the molecular weight of 1-Propenyl-(4-hydroxyphenyl)ketone?
The molecular weight of 1-Propenyl-(4-hydroxyphenyl)ketone is 294.3 g/mol.
What is the IUPAC name of 1-Propenyl-(4-hydroxyphenyl)ketone?
The IUPAC name of 1-Propenyl-(4-hydroxyphenyl)ketone is bis[4-hydroxy-2-[(E)-prop-1-enyl]phenyl]methanone.
What is the synonyms name for 1-Propenyl-(4-hydroxyphenyl)ketone?
The synonyms name for 1-Propenyl-(4-hydroxyphenyl)ketone is 939-49-1.
What is the InChI of 1-Propenyl-(4-hydroxyphenyl)ketone?
The InChI of 1-Propenyl-(4-hydroxyphenyl)ketone is InChI=1S/C19H18O3/c1-3-5-13-11-15(20)7-9-17(13)19(22)18-10-8-16(21)12-14(18)6-4-2/h3-12,20-21H,1-2H3/b5-3+,6-4+.
What is the InChIKey of 1-Propenyl-(4-hydroxyphenyl)ketone?
The InChIKey of 1-Propenyl-(4-hydroxyphenyl)ketone is RFGKUWXUTDUIJI-GGWOSOGESA-N.
What is the canonical SMILES of 1-Propenyl-(4-hydroxyphenyl)ketone?
The canonical SMILES of 1-Propenyl-(4-hydroxyphenyl)ketone is CC=CC1=C(C=CC(=C1)O)C(=O)C2=C(C=C(C=C2)O)C=CC.
How many hydrogen bond donor counts are there in 1-Propenyl-(4-hydroxyphenyl)ketone?
There are 2 hydrogen bond donor counts in 1-Propenyl-(4-hydroxyphenyl)ketone.
How many hydrogen bond acceptor counts are there in 1-Propenyl-(4-hydroxyphenyl)ketone?
There are 3 hydrogen bond acceptor counts in 1-Propenyl-(4-hydroxyphenyl)ketone.
How many rotatable bond counts are there in 1-Propenyl-(4-hydroxyphenyl)ketone?
There are 4 rotatable bond counts in 1-Propenyl-(4-hydroxyphenyl)ketone.
※ Please kindly note that our products are for research use only.