What is the molecular formula of 2-Bromomethylnaphthalene?
The molecular formula of 2-Bromomethylnaphthalene is C11H9Br.
What is the molecular weight of 2-Bromomethylnaphthalene?
The molecular weight of 2-Bromomethylnaphthalene is 221.09 g/mol.
What is the IUPAC Name of 2-Bromomethylnaphthalene?
The IUPAC Name of 2-Bromomethylnaphthalene is 2-(bromomethyl)naphthalene.
What is the InChI of 2-Bromomethylnaphthalene?
The InChI of 2-Bromomethylnaphthalene is InChI=1S/C11H9Br/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2.
What is the InChIKey of 2-Bromomethylnaphthalene?
The InChIKey of 2-Bromomethylnaphthalene is RUHJZSZTSCSTCC-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromomethylnaphthalene?
The Canonical SMILES of 2-Bromomethylnaphthalene is C1=CC=C2C=C(C=CC2=C1)CBr.
What is the CAS number of 2-Bromomethylnaphthalene?
The CAS number of 2-Bromomethylnaphthalene is 939-26-4.
What is the European Community (EC) Number of 2-Bromomethylnaphthalene?
The European Community (EC) Number of 2-Bromomethylnaphthalene is 213-359-5.
What is the Nikkaji Number of 2-Bromomethylnaphthalene?
The Nikkaji Number of 2-Bromomethylnaphthalene is J149.364G.
Is 2-Bromomethylnaphthalene a canonicalized compound?
Yes, 2-Bromomethylnaphthalene is a canonicalized compound according to PubChem.