What is the PubChem CID of (2-Methyl-1-oxooctyl)ferrocene?
The PubChem CID of (2-Methyl-1-oxooctyl)ferrocene is 56844074.
What is the molecular formula of (2-Methyl-1-oxooctyl)ferrocene?
The molecular formula of (2-Methyl-1-oxooctyl)ferrocene is C19H26FeO.
What are the synonyms of (2-Methyl-1-oxooctyl)ferrocene?
The synonyms of (2-Methyl-1-oxooctyl)ferrocene are EINECS 299-761-1, 93894-61-2, and DTXSID90917239.
What is the molecular weight of (2-Methyl-1-oxooctyl)ferrocene?
The molecular weight of (2-Methyl-1-oxooctyl)ferrocene is 326.3 g/mol.
What is the IUPAC name of (2-Methyl-1-oxooctyl)ferrocene?
The IUPAC name of (2-Methyl-1-oxooctyl)ferrocene is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-ylidene-2-methyloctan-1-olate;iron(2+).
What is the InChI of (2-Methyl-1-oxooctyl)ferrocene?
The InChI of (2-Methyl-1-oxooctyl)ferrocene is InChI=1S/C14H22O.C5H5.Fe/c1-3-4-5-6-9-12(2)14(15)13-10-7-8-11-13;1-2-4-5-3-1;/h7-8,10-12,15H,3-6,9H2,1-2H3;1-5H;/q;-1;+2/p-1.
What is the InChIKey of (2-Methyl-1-oxooctyl)ferrocene?
The InChIKey of (2-Methyl-1-oxooctyl)ferrocene is XGURLILJBHWFOD-UHFFFAOYSA-M.
What is the canonical SMILES of (2-Methyl-1-oxooctyl)ferrocene?
The canonical SMILES of (2-Methyl-1-oxooctyl)ferrocene is CCCCCCC(C)C(=C1C=CC=C1)[O-].[CH-]1C=CC=C1.[Fe+2].
What is the CAS number of (2-Methyl-1-oxooctyl)ferrocene?
The CAS number of (2-Methyl-1-oxooctyl)ferrocene is 93894-61-2.
What is the European Community (EC) number of (2-Methyl-1-oxooctyl)ferrocene?
The European Community (EC) number of (2-Methyl-1-oxooctyl)ferrocene is 299-761-1.
※ Please kindly note that our products are for research use only.