What is the molecular formula of 2-Dodecyl-1,3-phenylene diisocyanate?
The molecular formula of 2-Dodecyl-1,3-phenylene diisocyanate is C20H28N2O2.
When was 2-Dodecyl-1,3-phenylene diisocyanate created?
2-Dodecyl-1,3-phenylene diisocyanate was created on August 20, 2009.
What is the IUPAC name of 2-Dodecyl-1,3-phenylene diisocyanate?
The IUPAC name of 2-Dodecyl-1,3-phenylene diisocyanate is 2-dodecyl-1,3-diisocyanatobenzene.
What is the InChI of 2-Dodecyl-1,3-phenylene diisocyanate?
The InChI of 2-Dodecyl-1,3-phenylene diisocyanate is InChI=1S/C20H28N2O2/c1-2-3-4-5-6-7-8-9-10-11-13-18-19(21-16-23)14-12-15-20(18)22-17-24/h12,14-15H,2-11,13H2,1H3.
What is the Canonical SMILES of 2-Dodecyl-1,3-phenylene diisocyanate?
The Canonical SMILES of 2-Dodecyl-1,3-phenylene diisocyanate is CCCCCCCCCCCCC1=C(C=CC=C1N=C=O)N=C=O.
What is the molecular weight of 2-Dodecyl-1,3-phenylene diisocyanate?
The molecular weight of 2-Dodecyl-1,3-phenylene diisocyanate is 328.4 g/mol.
How many hydrogen bond acceptor counts are there in 2-Dodecyl-1,3-phenylene diisocyanate?
There are 4 hydrogen bond acceptor counts in 2-Dodecyl-1,3-phenylene diisocyanate.
What is the topological polar surface area of 2-Dodecyl-1,3-phenylene diisocyanate?
The topological polar surface area of 2-Dodecyl-1,3-phenylene diisocyanate is 58.9 ².
How many rotatable bond counts are there in 2-Dodecyl-1,3-phenylene diisocyanate?
There are 13 rotatable bond counts in 2-Dodecyl-1,3-phenylene diisocyanate.
Is 2-Dodecyl-1,3-phenylene diisocyanate a canonicalized compound?
Yes, 2-Dodecyl-1,3-phenylene diisocyanate is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.
Download
![Decaammonium[2,5,8,11,14,17-hexakis(phosphonatomethyl)-2,5,8,11,14,17-hexaazaoctadecane-1,18-diyl]bisphosphonate](https://resource.alfa-chemistry.com/structure/93858-92-5.gif)
![3,3'-(4,5,6,7-Tetrabromo-3-oxo-1(3H)-isobenzofuranylidene)bis[2,4-dichloro-6-hydroxybenzenesulfonic]acid](https://resource.alfa-chemistry.com/structure/93858-94-7.gif)
