What is the molecular formula of Hexacosyl methacrylate?
The molecular formula of Hexacosyl methacrylate is C30H58O2.
When was Hexacosyl methacrylate created in PubChem?
Hexacosyl methacrylate was created in PubChem on August 8, 2005.
What is the molecular weight of Hexacosyl methacrylate?
The molecular weight of Hexacosyl methacrylate is 450.8 g/mol.
What is the IUPAC name of Hexacosyl methacrylate?
The IUPAC name of Hexacosyl methacrylate is hexacosyl 2-methylprop-2-enoate.
What is the InChI of Hexacosyl methacrylate?
The InChI of Hexacosyl methacrylate is InChI=1S/C30H58O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-32-30(31)29(2)3/h2,4-28H2,1,3H3.
What is the Canonical SMILES of Hexacosyl methacrylate?
The Canonical SMILES of Hexacosyl methacrylate is CCCCCCCCCCCCCCCCCCCCCCCCCCOC(=O)C(=C)C.
What is the CAS number of Hexacosyl methacrylate?
The CAS number of Hexacosyl methacrylate is 93857-95-5.
How many Rotatable Bond Count does Hexacosyl methacrylate have?
Hexacosyl methacrylate has 27 Rotatable Bond Count.
What is the Formal Charge of Hexacosyl methacrylate?
The Formal Charge of Hexacosyl methacrylate is 0.
Is the Compound Is Canonicalized for Hexacosyl methacrylate?
Yes, the Compound Is Canonicalized for Hexacosyl methacrylate according to PubChem.