What is the molecular formula of Sodium 3-deoxygluconate?
The molecular formula of Sodium 3-deoxygluconate is C6H11NaO6.
What are the synonyms of Sodium 3-deoxygluconate?
The synonyms of Sodium 3-deoxygluconate are Sodium 3-deoxyhexonate and DTXSID00917447.
What is the molecular weight of Sodium 3-deoxygluconate?
The molecular weight of Sodium 3-deoxygluconate is 202.14 g/mol.
What is the parent compound of Sodium 3-deoxygluconate?
The parent compound of Sodium 3-deoxygluconate is CID 14122626 (3-Deoxy-d-ribo-hexonic acid).
What is the IUPAC name of Sodium 3-deoxygluconate?
The IUPAC name of Sodium 3-deoxygluconate is sodium;(2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoate.
What is the InChI of Sodium 3-deoxygluconate?
The InChI of Sodium 3-deoxygluconate is InChI=1S/C6H12O6.Na/c7-2-5(10)3(8)1-4(9)6(11)12;/h3-5,7-10H,1-2H2,(H,11,12);/q;+1/p-1/t3-,4+,5+;/m0./s1.
What is the InChIKey of Sodium 3-deoxygluconate?
The InChIKey of Sodium 3-deoxygluconate is ZRBXQRZQHABLKN-UJPDDDSFSA-M.
What is the canonical SMILES of Sodium 3-deoxygluconate?
The canonical SMILES of Sodium 3-deoxygluconate is C(C(C(CO)O)O)C(C(=O)[O-])O.[Na+].
What is the CAS number of Sodium 3-deoxygluconate?
The CAS number of Sodium 3-deoxygluconate is 93857-41-1.
What is the formal charge of Sodium 3-deoxygluconate?
The formal charge of Sodium 3-deoxygluconate is 0.
Download
![Ethylene bis[[(8-dodecyl-5,11-dioxo-1,4-dioxa-7,9-dithia-8-stannacycloundec-8-yl)thio]acetate]](https://resource.alfa-chemistry.com/structure/93857-18-2.gif)
