What is the molecular formula of 5,9-Dimethyl-2-decenal?
The molecular formula is C12H22O.
What are the synonyms for 5,9-Dimethyl-2-decenal?
The synonyms are 93840-78-9, EINECS 298-944-3, and NSC 26524.
What is the molecular weight of 5,9-Dimethyl-2-decenal?
The molecular weight is 182.30 g/mol.
When was 5,9-Dimethyl-2-decenal created in PubChem?
It was created on September 6, 2005.
What is the IUPAC name of 5,9-Dimethyl-2-decenal?
The IUPAC name is (E)-5,9-dimethyldec-2-enal.
What is the InChI of 5,9-Dimethyl-2-decenal?
The InChI is InChI=1S/C12H22O/c1-11(2)7-6-9-12(3)8-4-5-10-13/h4-5,10-12H,6-9H2,1-3H3/b5-4+.
What is the InChIKey of 5,9-Dimethyl-2-decenal?
The InChIKey is ROXNDLMMXXKEMM-SNAWJCMRSA-N.
What is the canonical SMILES of 5,9-Dimethyl-2-decenal?
The canonical SMILES is CC(C)CCCC(C)CC=CC=O.
What is the isomeric SMILES of 5,9-Dimethyl-2-decenal?
The isomeric SMILES is CC(C)CCCC(C)C/C=C/C=O.
What is the XLogP3-AA value of 5,9-Dimethyl-2-decenal?
The XLogP3-AA value is 4.2.