The molecular formula of the compound is C23H21N3O8S.
What is the molecular weight of the compound?
The molecular weight of the compound is 499.5 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-ethyl-3,8-dinitro-6-phenylphenanthridin-5-ium;ethyl sulfate.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C21H16N3O4.C2H6O4S/c1-2-22-20-13-16(24(27)28)9-11-18(20)17-10-8-15(23(25)26)12-19(17)21(22)14-6-4-3-5-7-14;1-2-6-7(3,4)5/h3-13H,2H2,1H3;2H2,1H3,(H,3,4,5)/q+1;/p-1
What is the InChIKey of the compound?
The InChIKey of the compound is KVSATGGMSSOVOB-UHFFFAOYSA-M.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is CC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)[N+](=O)[O-])[N+](=O)[O-].CCOS(=O)(=O)[O-].
What is the CAS number of the compound?
The CAS number of the compound is 93840-65-4.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor count.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 170 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.