What is the molecular formula of DL-Lysin L-ascorbate?
The molecular formula of DL-Lysin L-ascorbate is C12H22N2O8.
What are the synonyms for DL-Lysin L-ascorbate?
The synonyms for DL-Lysin L-ascorbate are EINECS 298-517-1 and 93805-34-6.
What is the molecular weight of DL-Lysin L-ascorbate?
The molecular weight of DL-Lysin L-ascorbate is 322.31 g/mol.
What are the component compounds of DL-Lysin L-ascorbate?
The component compounds of DL-Lysin L-ascorbate are Lysine, DL- and Ascorbic Acid.
What is the IUPAC name of DL-Lysin L-ascorbate?
The IUPAC name of DL-Lysin L-ascorbate is 2,6-diaminohexanoic acid;(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one.
What is the InChIKey of DL-Lysin L-ascorbate?
The InChIKey of DL-Lysin L-ascorbate is QPNXLUIFXPXQCB-MGMRMFRLSA-N.
What is the Canonical SMILES of DL-Lysin L-ascorbate?
The Canonical SMILES of DL-Lysin L-ascorbate is C(CCN)CC(C(=O)O)N.C(C(C1C(=C(C(=O)O1)O)O)O)O.
What is the CAS number of DL-Lysin L-ascorbate?
The CAS number of DL-Lysin L-ascorbate is 93805-34-6.
What is the hydrogen bond donor count of DL-Lysin L-ascorbate?
The hydrogen bond donor count of DL-Lysin L-ascorbate is 7.
Is DL-Lysin L-ascorbate a canonicalized compound?
Yes, DL-Lysin L-ascorbate is a canonicalized compound.