What is the molecular formula of 2-Methyldecyl acrylate?
The molecular formula of 2-Methyldecyl acrylate is C14H26O2.
What is the molecular weight of 2-Methyldecyl acrylate?
The molecular weight of 2-Methyldecyl acrylate is 226.35 g/mol.
What is the IUPAC name of 2-Methyldecyl acrylate?
The IUPAC name of 2-Methyldecyl acrylate is 2-methyldecyl prop-2-enoate.
What is the InChI of 2-Methyldecyl acrylate?
The InChI of 2-Methyldecyl acrylate is InChI=1S/C14H26O2/c1-4-6-7-8-9-10-11-13(3)12-16-14(15)5-2/h5,13H,2,4,6-12H2,1,3H3.
What is the InChIKey of 2-Methyldecyl acrylate?
The InChIKey of 2-Methyldecyl acrylate is OVZNCXVUIWIDLP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methyldecyl acrylate?
The canonical SMILES of 2-Methyldecyl acrylate is CCCCCCCCC(C)COC(=O)C=C.
What is the CAS number of 2-Methyldecyl acrylate?
The CAS number of 2-Methyldecyl acrylate is 93804-47-8.
What is the European Community (EC) number of 2-Methyldecyl acrylate?
The European Community (EC) number of 2-Methyldecyl acrylate is 298-423-0.
What is the XLogP3-AA value of 2-Methyldecyl acrylate?
The XLogP3-AA value of 2-Methyldecyl acrylate is 5.6.
How many rotatable bond counts does 2-Methyldecyl acrylate have?
2-Methyldecyl acrylate has 11 rotatable bond counts.