What is the molecular formula of 4-Hydroxy Phenylglycine?
The molecular formula of 4-Hydroxy Phenylglycine is C8H9NO3.
What is the molecular weight of 4-Hydroxy Phenylglycine?
The molecular weight of 4-Hydroxy Phenylglycine is 167.16 g/mol.
What is the IUPAC name of 4-Hydroxy Phenylglycine?
The IUPAC name of 4-Hydroxy Phenylglycine is 2-(4-hydroxyanilino)acetic acid.
What is the InChI of 4-Hydroxy Phenylglycine?
The InChI of 4-Hydroxy Phenylglycine is InChI=1S/C8H9NO3/c10-7-3-1-6(2-4-7)9-5-8(11)12/h1-4,9-10H,5H2,(H,11,12).
What is the InChIKey of 4-Hydroxy Phenylglycine?
The InChIKey of 4-Hydroxy Phenylglycine is WRUZLCLJULHLEY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hydroxy Phenylglycine?
The canonical SMILES of 4-Hydroxy Phenylglycine is C1=CC(=CC=C1NCC(=O)O).
What is the CAS number of 4-Hydroxy Phenylglycine?
The CAS number of 4-Hydroxy Phenylglycine is 122-87-2.
How many hydrogen bond donor counts does 4-Hydroxy Phenylglycine have?
4-Hydroxy Phenylglycine has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Hydroxy Phenylglycine have?
4-Hydroxy Phenylglycine has 4 hydrogen bond acceptor counts.