What is the molecular formula of Sodium ascorbate?
The molecular formula of Sodium ascorbate is C6H7O6.Na.
What is the molecular weight of Sodium ascorbate?
The molecular weight of Sodium ascorbate is 198.11 g/mol.
What is the role of Sodium ascorbate?
Sodium ascorbate has a role as a food antioxidant, a flour treatment agent, a coenzyme, and a reducing agent.
Where is Sodium ascorbate found naturally?
Sodium ascorbate is found naturally in citrus fruits and many vegetables.
What is the chemical structure of Sodium ascorbate?
The chemical structure of Sodium ascorbate involves the replacement of the proton from the 3-hydroxy group of ascorbic acid by a sodium ion.
What is the IUPAC name of Sodium ascorbate?
The IUPAC name of Sodium ascorbate is sodium;(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate.
What is the InChIKey of Sodium ascorbate?
The InChIKey of Sodium ascorbate is PPASLZSBLFJQEF-RXSVEWSESA-M.
What is the Canonical SMILES of Sodium ascorbate?
The Canonical SMILES of Sodium ascorbate is C(C(C1C(=C(C(=O)O1)O)[O-])O)O.[Na+].
How is Sodium ascorbate used in metabolic pathways?
Sodium ascorbate's biologically active form, vitamin C, functions as a reducing agent and coenzyme in several metabolic pathways.
What is the pH range of aqueous solutions of Sodium ascorbate?
The pH of aqueous solutions of Sodium ascorbate ranges from 5.6 to 7.0 or even higher.
What is the parent compound of sodium ascorbate?
The parent compound of sodium ascorbate is ascorbic acid.
What is the CAS number of sodium ascorbate?
The CAS number of sodium ascorbate is 134-03-2.
What is the Wikipedia page of sodium ascorbate?
The Wikipedia page of sodium ascorbate is Sodium ascorbate.