What is the molecular formula of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The molecular formula is C42H84O4.
When was the structure of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate created and modified?
The structure was created on 2005-08-08 and modified on 2023-12-30.
What is the IUPAC name of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The IUPAC name is 2-hydroxytetracosyl 12-hydroxyoctadecanoate.
What is the InChI of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The InChI is InChI=1S/C42H84O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-29-33-37-41(44)39-46-42(45)38-34-30-27-24-23-25-28-32-36-40(43)35-31-8-6-4-2/h40-41,43-44H,3-39H2,1-2H3.
What is the CAS number for 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The CAS number is 93778-45-1.
What is the molecular weight of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The molecular weight is 653.1 g/mol.
How many hydrogen bond donor counts are there in 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
There are 2 hydrogen bond donor counts.
What is the XLogP3-AA value of 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
The XLogP3-AA value is 17.6.
How many rotatable bond counts are there in 2-Hydroxytetracosyl 12-hydroxyoctadecanoate?
There are 40 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.
※ Please kindly note that our products are for research use only.