What is the molecular formula of Betaine D-galacturonate?
The molecular formula of Betaine D-galacturonate is C11H21NO9.
What is the molecular weight of Betaine D-galacturonate?
The molecular weight of Betaine D-galacturonate is 311.29 g/mol.
What are some synonyms for Betaine D-galacturonate?
Some synonyms for Betaine D-galacturonate are 93778-40-6, DTXSID20239633, EINECS 298-176-9, and D-Galacturonic acid, ion(1-), 1-carboxy-N,N,N-trimethylmethanaminium.
What is the IUPAC name of Betaine D-galacturonate?
The IUPAC name of Betaine D-galacturonate is carboxymethyl(trimethyl)azanium;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
What is the InChI of Betaine D-galacturonate?
The InChI of Betaine D-galacturonate is InChI=1S/C6H10O7.C5H11NO2/c7-1-2(8)3(9)4(10)5(11)6(12)13;1-6(2,3)4-5(7)8/h1-5,8-11H,(H,12,13);4H2,1-3H3/t2-,3+,4+,5-;/m0.
What is the InChIKey of Betaine D-galacturonate?
The InChIKey of Betaine D-galacturonate is NTRGSJJAAMSXHU-RMTXHFLUSA-N.
What is the canonical SMILES of Betaine D-galacturonate?
The canonical SMILES of Betaine D-galacturonate is C[N+](C)(C)CC(=O)O.C(=O)C(C(C(C(C(=O)[O-])O)O)O)O.
What is the isomeric SMILES of Betaine D-galacturonate?
The isomeric SMILES of Betaine D-galacturonate is C[N+](C)(C)CC(=O)O.C(=O)[C@@H]([C@H]([C@H]([C@@H](C(=O)[O-])O)O)O)O.
What is the CAS number of Betaine D-galacturonate?
The CAS number of Betaine D-galacturonate is 93778-40-6.
Is Betaine D-galacturonate a canonicalized compound?
Yes, Betaine D-galacturonate is a canonicalized compound.