What is the molecular formula of 2-Hexyldecyl octanoate?
The molecular formula of 2-Hexyldecyl octanoate is C24H48O2.
When was 2-Hexyldecyl octanoate created?
2-Hexyldecyl octanoate was created on August 8, 2005.
What is the IUPAC Name of 2-Hexyldecyl octanoate?
The IUPAC Name of 2-Hexyldecyl octanoate is 2-hexyldecyl octanoate.
What is the molecular weight of 2-Hexyldecyl octanoate?
The molecular weight of 2-Hexyldecyl octanoate is 368.6 g/mol.
What is the Canonical SMILES representation of 2-Hexyldecyl octanoate?
The Canonical SMILES representation of 2-Hexyldecyl octanoate is CCCCCCCCC(CCCCCC)COC(=O)CCCCCCC.
How many Hydrogen Bond Acceptor Count does 2-Hexyldecyl octanoate have?
2-Hexyldecyl octanoate has 2 Hydrogen Bond Acceptor Count.
What is the XLogP3-AA value of 2-Hexyldecyl octanoate?
The XLogP3-AA value of 2-Hexyldecyl octanoate is 10.6.
What is the Topological Polar Surface Area of 2-Hexyldecyl octanoate?
The Topological Polar Surface Area of 2-Hexyldecyl octanoate is 26.3 Ų.
Does 2-Hexyldecyl octanoate have any Defined Atom Stereocenter Count?
No, 2-Hexyldecyl octanoate does not have any Defined Atom Stereocenter Count.
Is 2-Hexyldecyl octanoate Canonicalized?
Yes, 2-Hexyldecyl octanoate is Canonicalized according to PubChem.