What is the molecular formula of 2-Chloroethyl-d4 methyl sulfide?
The molecular formula is C3H7ClS.
What are the synonyms for 2-Chloroethyl-d4 methyl sulfide?
The synonyms are 2-Chloroethyl-d4 methyl sulfide, 93709-60-5, 1-chloro-1,1,2,2-tetradeuterio-2-methylsulfanylethane, and 1-chloro-2-(methylsulfanyl)(?H?)ethane.
What is the molecular weight of 2-Chloroethyl-d4 methyl sulfide?
The molecular weight is 114.63 g/mol.
When was 2-Chloroethyl-d4 methyl sulfide created and last modified?
It was created on February 16, 2015, and last modified on December 30, 2023.
What is the IUPAC name of 2-Chloroethyl-d4 methyl sulfide?
The IUPAC name is 1-chloro-1,1,2,2-tetradeuterio-2-methylsulfanylethane.
What is the InChI of 2-Chloroethyl-d4 methyl sulfide?
The InChI is InChI=1S/C3H7ClS/c1-5-3-2-4/h2-3H2,1H3/i2D2,3D2.
What is the InChIKey of 2-Chloroethyl-d4 methyl sulfide?
The InChIKey is MYFKLQFBFSHBPA-RRVWJQJTSA-N.
What is the canonical SMILES of 2-Chloroethyl-d4 methyl sulfide?
The canonical SMILES is CSCCCl.
What is the isomeric SMILES of 2-Chloroethyl-d4 methyl sulfide?
The isomeric SMILES is [2H]C([2H])(C([2H])([2H])Cl)SC.
What is the XLogP3-AA value of 2-Chloroethyl-d4 methyl sulfide?
The XLogP3-AA value is 1.5.
※ Please kindly note that our products are for research use only.