What is the molecular formula of phenylacetic hydrazide?
The molecular formula of phenylacetic hydrazide is C8H10N2O.
What is the molecular weight of phenylacetic hydrazide?
The molecular weight of phenylacetic hydrazide is 150.18 g/mol.
What is the IUPAC name of phenylacetic hydrazide?
The IUPAC name of phenylacetic hydrazide is 2-phenylacetohydrazide.
What is the InChI of phenylacetic hydrazide?
The InChI of phenylacetic hydrazide is InChI=1S/C8H10N2O/c9-10-8(11)6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11).
What is the InChIKey of phenylacetic hydrazide?
The InChIKey of phenylacetic hydrazide is FPTCVTJCJMVIDV-UHFFFAOYSA-N.
What is the canonical SMILES of phenylacetic hydrazide?
The canonical SMILES of phenylacetic hydrazide is C1=CC=C(C=C1)CC(=O)NN.
What is the CAS number of phenylacetic hydrazide?
The CAS number of phenylacetic hydrazide is 937-39-3.
What is the XLogP3 value of phenylacetic hydrazide?
The XLogP3 value of phenylacetic hydrazide is 0.4.
How many hydrogen bond donor counts does phenylacetic hydrazide have?
Phenylacetic hydrazide has 2 hydrogen bond donor counts.
How many rotatable bond counts does phenylacetic hydrazide have?
Phenylacetic hydrazide has 2 rotatable bond counts.