What is the molecular formula of 1,3-Dioxolane, 2-phenyl?
The molecular formula of 1,3-Dioxolane, 2-phenyl is C9H10O2.
What is the molecular weight of 1,3-Dioxolane, 2-phenyl?
The molecular weight of 1,3-Dioxolane, 2-phenyl is 150.17 g/mol.
What is the IUPAC name of 1,3-Dioxolane, 2-phenyl?
The IUPAC name of 1,3-Dioxolane, 2-phenyl is 2-phenyl-1,3-dioxolane.
What is the InChI of 1,3-Dioxolane, 2-phenyl?
The InChI of 1,3-Dioxolane, 2-phenyl is InChI=1S/C9H10O2/c1-2-4-8(5-3-1)9-10-6-7-11-9/h1-5,9H,6-7H2.
What is the InChIKey of 1,3-Dioxolane, 2-phenyl?
The InChIKey of 1,3-Dioxolane, 2-phenyl is LYINTWKRUWVLBA-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dioxolane, 2-phenyl?
The canonical SMILES of 1,3-Dioxolane, 2-phenyl is C1COC(O1)C2=CC=CC=C2.
What is the CAS number of 1,3-Dioxolane, 2-phenyl?
The CAS number of 1,3-Dioxolane, 2-phenyl is 936-51-6.
What is the EC number of 1,3-Dioxolane, 2-phenyl?
The EC number of 1,3-Dioxolane, 2-phenyl is 213-315-5.
What is the DSSTox Substance ID of 1,3-Dioxolane, 2-phenyl?
The DSSTox Substance ID of 1,3-Dioxolane, 2-phenyl is DTXSID00239479.
Is 1,3-Dioxolane, 2-phenyl a covalently-bonded unit?
Yes, 1,3-Dioxolane, 2-phenyl is a covalently-bonded unit with a count of 1.