What is the molecular formula of 2-(2-Furanoyl)pyridine?
The molecular formula of 2-(2-Furanoyl)pyridine is C10H7NO2.
When was the structure of 2-(2-Furanoyl)pyridine created and modified?
The structure was created on 2005-07-19 and modified on 2023-12-30.
What is the IUPAC name of 2-(2-Furanoyl)pyridine?
The IUPAC name of 2-(2-Furanoyl)pyridine is furan-2-yl(pyridin-2-yl)methanone.
What is the InChIKey of 2-(2-Furanoyl)pyridine?
The InChIKey of 2-(2-Furanoyl)pyridine is FVTWPXKINZWYEB-UHFFFAOYSA-N.
What is the canonical SMILES notation for 2-(2-Furanoyl)pyridine?
The canonical SMILES notation for 2-(2-Furanoyl)pyridine is C1=CC=NC(=C1)C(=O)C2=CC=CO2.
What is the CAS number for 2-(2-Furanoyl)pyridine?
The CAS number for 2-(2-Furanoyl)pyridine is 93560-49-7.
What is the molecular weight of 2-(2-Furanoyl)pyridine?
The molecular weight of 2-(2-Furanoyl)pyridine is 173.17 g/mol.
How many hydrogen bond acceptor counts does 2-(2-Furanoyl)pyridine have?
2-(2-Furanoyl)pyridine has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 2-(2-Furanoyl)pyridine?
The topological polar surface area of 2-(2-Furanoyl)pyridine is 43.1 Å2.
Is 2-(2-Furanoyl)pyridine a canonicalized compound according to PubChem?
Yes, 2-(2-Furanoyl)pyridine is a canonicalized compound in PubChem.