What is the molecular formula of 1-Chloroadamantane?
The molecular formula of 1-Chloroadamantane is C10H15Cl.
How much does 1-Chloroadamantane weigh?
1-Chloroadamantane weighs 170.68 g/mol.
What is the IUPAC name of 1-Chloroadamantane?
The IUPAC name of 1-Chloroadamantane is 1-chloroadamantane.
What is the InChI of 1-Chloroadamantane?
The InChI of 1-Chloroadamantane is InChI=1S/C10H15Cl/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9H,1-6H2.
What is the InChIKey of 1-Chloroadamantane?
The InChIKey of 1-Chloroadamantane is OZNXTQSXSHODFR-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Chloroadamantane?
The canonical SMILES of 1-Chloroadamantane is C1C2CC3CC1CC(C2)(C3)Cl.
What is the CAS number of 1-Chloroadamantane?
The CAS number of 1-Chloroadamantane is 935-56-8.
What is the European Community (EC) number of 1-Chloroadamantane?
The European Community (EC) number of 1-Chloroadamantane is 213-305-0.
What is the UNII of 1-Chloroadamantane?
The UNII of 1-Chloroadamantane is HOZ9S5Z71H.
Is 1-Chloroadamantane a covalently-bonded unit?
Yes, 1-Chloroadamantane is a covalently-bonded unit.