What is the molecular formula of Glycylglycyl-L-histidine?
The molecular formula of Glycylglycyl-L-histidine is C10H15N5O4.
What is the molecular weight of Glycylglycyl-L-histidine?
The molecular weight of Glycylglycyl-L-histidine is 269.26 g/mol.
What is the IUPAC name of Glycylglycyl-L-histidine?
The IUPAC name of Glycylglycyl-L-histidine is (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
What is the InChI of Glycylglycyl-L-histidine?
The InChI of Glycylglycyl-L-histidine is InChI=1S/C10H15N5O4/c11-2-8(16)13-4-9(17)15-7(10(18)19)1-6-3-12-5-14-6/h3,5,7H,1-2,4,11H2,(H,12,14)(H,13,16)(H,15,17)(H,18,19)/t7-/m0/s1.
What is the InChIKey of Glycylglycyl-L-histidine?
The InChIKey of Glycylglycyl-L-histidine is PDAWDNVHMUKWJR-ZETCQYMHSA-N.
What is the canonical SMILES of Glycylglycyl-L-histidine?
The canonical SMILES of Glycylglycyl-L-histidine is C1=C(NC=N1)CC(C(=O)O)NC(=O)CNC(=O)CN.
What are the synonyms of Glycylglycyl-L-histidine?
The synonyms of Glycylglycyl-L-histidine are H-Gly-Gly-His-OH, 7451-76-5, Diglycyl-histidine, Glycylglycyl-L-histidine, Gly-gly-his.
What is the XLogP3-AA value of Glycylglycyl-L-histidine?
The XLogP3-AA value of Glycylglycyl-L-histidine is -4.5.
How many hydrogen bond donor counts does Glycylglycyl-L-histidine have?
Glycylglycyl-L-histidine has 5 hydrogen bond donor counts.
Is Glycylglycyl-L-histidine a canonicalized compound?
Yes, Glycylglycyl-L-histidine is a canonicalized compound.