What is the molecular formula of Methyl 5-acetylaminolevulinate?
The molecular formula of Methyl 5-acetylaminolevulinate is C8H13NO4.
What are the synonyms for Methyl 5-acetylaminolevulinate?
The synonyms for Methyl 5-acetylaminolevulinate are 93393-93-2, Methyl 5-(acetylamino)-4-oxopentanoate, methyl 5-acetamido-4-oxopentanoate, and 5-acetamido-4-oxopentanoic acid methyl ester.
What is the molecular weight of Methyl 5-acetylaminolevulinate?
The molecular weight of Methyl 5-acetylaminolevulinate is 187.19 g/mol.
What is the IUPAC name of Methyl 5-acetylaminolevulinate?
The IUPAC name of Methyl 5-acetylaminolevulinate is methyl 5-acetamido-4-oxopentanoate.
What is the InChI of Methyl 5-acetylaminolevulinate?
The InChI of Methyl 5-acetylaminolevulinate is InChI=1S/C8H13NO4/c1-6(10)9-5-7(11)3-4-8(12)13-2/h3-5H2,1-2H3,(H,9,10).
What is the InChIKey of Methyl 5-acetylaminolevulinate?
The InChIKey of Methyl 5-acetylaminolevulinate is ODTLWRJIPVEESK-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 5-acetylaminolevulinate?
The canonical SMILES of Methyl 5-acetylaminolevulinate is CC(=O)NCC(=O)CCC(=O)OC.
What is the CAS number of Methyl 5-acetylaminolevulinate?
The CAS number of Methyl 5-acetylaminolevulinate is 93393-93-2.
Is Methyl 5-acetylaminolevulinate a canonicalized compound?
Yes, Methyl 5-acetylaminolevulinate is a canonicalized compound.
※ Please kindly note that our products are for research use only.