What is the molecular formula of the compound?
The molecular formula is C12H10N2O2S.
What is the molecular weight of the compound?
The molecular weight is 246.29 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is 2-hydroxy-N-[(Z)-thiophen-2-ylmethylideneamino]benzamide.
What is the InChI of the compound?
The InChI is InChI=1S/C12H10N2O2S/c15-11-6-2-1-5-10(11)12(16)14-13-8-9-4-3-7-17-9/h1-8,15H,(H,14,16)/b13-8-.
What is the InChIKey of the compound?
The InChIKey is OLDVIXVCAVKNTM-JYRVWZFOSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC=C(C(=C1)C(=O)NN=CC2=CC=CS2)O.
What is the isomeric SMILES of the compound?
The isomeric SMILES is C1=CC=C(C(=C1)C(=O)N/N=C\C2=CC=CS2)O.
What is the CAS number of the compound?
The CAS number is 93352-51-3.
What is the European Community (EC) number of the compound?
The European Community (EC) number is 658-981-1.
Is the compound canonicalized?
Yes, the compound is canonicalized.