What is the molecular formula of Pentafluorobenzyl p-Toluenesulfonate?
The molecular formula of Pentafluorobenzyl p-Toluenesulfonate is C14H9F5O3S.
What is the molecular weight of Pentafluorobenzyl p-Toluenesulfonate?
The molecular weight of Pentafluorobenzyl p-Toluenesulfonate is 352.28 g/mol.
What are some synonyms of Pentafluorobenzyl p-Toluenesulfonate?
Some synonyms of Pentafluorobenzyl p-Toluenesulfonate include 32974-36-0, p-Toluenesulfonic Acid Pentafluorobenzyl Ester, and (Perfluorophenyl)methyl 4-methylbenzenesulfonate.
What is the Canonical SMILES for Pentafluorobenzyl p-Toluenesulfonate?
The Canonical SMILES for Pentafluorobenzyl p-Toluenesulfonate is CC1=CC=C(C=C1)S(=O)(=O)OCC2=C(C(=C(C(=C2F)F)F)F)F.
What is the InChIKey for Pentafluorobenzyl p-Toluenesulfonate?
The InChIKey for Pentafluorobenzyl p-Toluenesulfonate is BKNSDBYJUGNUDL-UHFFFAOYSA-N.
How many hydrogen bond acceptors are in Pentafluorobenzyl p-Toluenesulfonate?
There are 8 hydrogen bond acceptors in Pentafluorobenzyl p-Toluenesulfonate.
What is the Exact Mass of Pentafluorobenzyl p-Toluenesulfonate?
The Exact Mass of Pentafluorobenzyl p-Toluenesulfonate is 352.01925613 g/mol.
Is Pentafluorobenzyl p-Toluenesulfonate a canonicalized compound?
Yes, Pentafluorobenzyl p-Toluenesulfonate is a canonicalized compound.
How many rotatable bonds are in Pentafluorobenzyl p-Toluenesulfonate?
There are 4 rotatable bonds in Pentafluorobenzyl p-Toluenesulfonate.
What is the Covalently-Bonded Unit Count of Pentafluorobenzyl p-Toluenesulfonate?
The Covalently-Bonded Unit Count of Pentafluorobenzyl p-Toluenesulfonate is 1.
※ Please kindly note that our products are for research use only.