What is the molecular formula of o-Toluoyl chloride?
The molecular formula of o-Toluoyl chloride is C8H7ClO.
What is the molecular weight of o-Toluoyl chloride?
The molecular weight of o-Toluoyl chloride is 154.59 g/mol.
What is the IUPAC name of o-Toluoyl chloride?
The IUPAC name of o-Toluoyl chloride is 2-methylbenzoyl chloride.
What is the InChI of o-Toluoyl chloride?
The InChI of o-Toluoyl chloride is InChI=1S/C8H7ClO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3.
What is the InChIKey of o-Toluoyl chloride?
The InChIKey of o-Toluoyl chloride is GPZXFICWCMCQPF-UHFFFAOYSA-N.
What is the canonical SMILES of o-Toluoyl chloride?
The canonical SMILES of o-Toluoyl chloride is CC1=CC=CC=C1C(=O)Cl.
What is the CAS number of o-Toluoyl chloride?
The CAS number of o-Toluoyl chloride is 933-88-0.
What is the XLogP3 value of o-Toluoyl chloride?
The XLogP3 value of o-Toluoyl chloride is 3.4.
How many hydrogen bond donor count does o-Toluoyl chloride have?
o-Toluoyl chloride has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does o-Toluoyl chloride have?
o-Toluoyl chloride has 1 hydrogen bond acceptor count.