The molecular formula of the compound is C11H18O2.
What are the synonyms for the compound?
The synonyms for the compound are 93257-18-2, Methyl 2-cyclohexylcyclopropane-1-carboxylate, 2-CYCLOHEXYLCYCLOPROPANECARBOXYLIC ACID METHYL ESTER, and FT-0720799.
What is the molecular weight of the compound?
The molecular weight of the compound is 182.26 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl 2-cyclohexylcyclopropane-1-carboxylate.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C11H18O2/c1-13-11(12)10-7-9(10)8-5-3-2-4-6-8/h8-10H,2-7H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is FTWXIVHWZYMFEP-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is COC(=O)C1CC1C2CCCCC2.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.2.
How many hydrogen bond donors does the compound have?
The compound has 0 hydrogen bond donors.
How many hydrogen bond acceptors does the compound have?
The compound has 2 hydrogen bond acceptors.
※ Please kindly note that our products are for research use only.