What is the molecular formula of 7-Chloromethyl 17r-drospirenone?
The molecular formula of 7-Chloromethyl 17r-drospirenone is C24H31ClO3.
What are the synonyms of 7-Chloromethyl 17r-drospirenone?
The synonyms of 7-Chloromethyl 17r-drospirenone include 7-Chloromethyl 17-epidrospirenone, 932388-89-1, 7-Chloromethyl 17R-Drospirenone, Drospirenone impurity H [EP], (+)-7-Chloromethyl 17-epidrospirenone.
What is the molecular weight of 7-Chloromethyl 17r-drospirenone?
The molecular weight of 7-Chloromethyl 17r-drospirenone is 403.0 g/mol.
When was 7-Chloromethyl 17r-drospirenone created?
7-Chloromethyl 17r-drospirenone was created on May 17, 2013.
What is the IUPAC name of 7-Chloromethyl 17r-drospirenone?
The IUPAC name of 7-Chloromethyl 17r-drospirenone is (1'R,2'S,3'S,5R,5'S,7'S,10'S,11'R,18'S)-18'-(chloromethyl)-7',11'-dimethylspiro[oxolane-5,6'-pentacyclo[8.8.0.0 2,7 .0 3,5 .0 11,16 ]octadec-15-ene]-2,14'-dione.
What is the InChI of 7-Chloromethyl 17r-drospirenone?
The InChI of 7-Chloromethyl 17r-drospirenone is InChI=1S/C24H31ClO3/c1-22-6-3-15(26)10-14(22)9-13(12-25)20-17(22)4-7-23(2)21(20)16-11-18(16)24(23)8-5-19(27)28-24/h10,13,16-18,20-21H,3-9,11-12H2,1-2H3/t13-,16-,17+,18+,20-,21+,22+,23+,24-/m1/s1.
What is the InChIKey of 7-Chloromethyl 17r-drospirenone?
The InChIKey of 7-Chloromethyl 17r-drospirenone is YGBFZJNESAZJNB-WUVPQEDYSA-N.
What is the canonical SMILES of 7-Chloromethyl 17r-drospirenone?
The canonical SMILES of 7-Chloromethyl 17r-drospirenone is CC12CCC(=O)C=C1CC(C3C2CCC4(C3C5CC5C46CCC(=O)O6)C)CCl.
What is the CAS number of 7-Chloromethyl 17r-drospirenone?
The CAS number of 7-Chloromethyl 17r-drospirenone is 932388-89-1.