The synonyms of the compound include Z-D-SER(TBU)-OME, 93204-37-6, methyl (2R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate, Z-O-tert-butyl-D-serine methyl ester, and SCHEMBL344382.
What is the molecular weight of the compound?
The molecular weight of the compound is 309.36 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is methyl (2R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)propanoate.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H23NO5/c1-16(2,3)22-11-13(14(18)20-4)17-15(19)21-10-12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3,(H,17,19)/t13-/m1/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is UMAXPCYVVRYQNO-CYBMUJFWSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)(C)OCC(C(=O)OC)NC(=O)OCC1=CC=CC=C1.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.2.
Does the compound have a defined atom stereocenter count?
Yes, the compound has a defined atom stereocenter count of 1.
※ Please kindly note that our products are for research use only.
Download
![O-[4-(N-Cyclopentyl-N-ethylamino)-2-hydroxybenzoyl]benzoic acid](https://resource.alfa-chemistry.com/structure/93205-19-7.gif)
