What is the molecular formula of 2-Acetyl-1-methylpyrrole?
The molecular formula of 2-Acetyl-1-methylpyrrole is C7H9NO.
What is the molecular weight of 2-Acetyl-1-methylpyrrole?
The molecular weight of 2-Acetyl-1-methylpyrrole is 123.15 g/mol.
What is the IUPAC name of 2-Acetyl-1-methylpyrrole?
The IUPAC name of 2-Acetyl-1-methylpyrrole is 1-(1-methylpyrrol-2-yl)ethanone.
What is the InChI of 2-Acetyl-1-methylpyrrole?
The InChI of 2-Acetyl-1-methylpyrrole is InChI=1S/C7H9NO/c1-6(9)7-4-3-5-8(7)2/h3-5H,1-2H3.
What is the InChIKey of 2-Acetyl-1-methylpyrrole?
The InChIKey of 2-Acetyl-1-methylpyrrole is NZFLWVDXYUGFAV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Acetyl-1-methylpyrrole?
The canonical SMILES of 2-Acetyl-1-methylpyrrole is CC(=O)C1=CC=CN1C.
What is the CAS number of 2-Acetyl-1-methylpyrrole?
The CAS number of 2-Acetyl-1-methylpyrrole is 932-16-1.
What is the FEMA number of 2-Acetyl-1-methylpyrrole?
The FEMA number of 2-Acetyl-1-methylpyrrole is 3184.
What is the JECFA number of 2-Acetyl-1-methylpyrrole?
The JECFA number of 2-Acetyl-1-methylpyrrole is 1306.
What is the formal charge of 2-Acetyl-1-methylpyrrole?
The formal charge of 2-Acetyl-1-methylpyrrole is 0.