What is the PubChem CID of Ciprofloxacin hydrochloride?
PubChem CID is 62999.
What is the molecular formula of Ciprofloxacin hydrochloride?
The molecular formula is C17H19ClFN3O3.
What are the synonyms of Ciprofloxacin hydrochloride?
The synonyms include Ciprofloxacin hydrochloride, Ciprofloxacin HCl, and 1-cyclopropyl-6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid hydrochloride.
What is the molecular weight of Ciprofloxacin hydrochloride?
The molecular weight is 367.8 g/mol.
What is the parent compound of Ciprofloxacin hydrochloride?
The parent compound is CID 2764 (Ciprofloxacin).
What are the component compounds of Ciprofloxacin hydrochloride?
The component compounds are Hydrochloric Acid (CID 313) and Ciprofloxacin (CID 2764).
What is the IUPAC name of Ciprofloxacin hydrochloride?
The IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid;hydrochloride.
What is the InChI of Ciprofloxacin hydrochloride?
The InChI is InChI=1S/C17H18FN3O3.ClH/c18-13-7-11-14(8-15(13)20-5-3-19-4-6-20)21(10-1-2-10)9-12(16(11)22)17(23)24;/h7-10,19H,1-6H2,(H,23,24);1H.
What is the InChIKey of Ciprofloxacin hydrochloride?
The InChIKey is DIOIOSKKIYDRIQ-UHFFFAOYSA-N.
What is the canonical SMILES of Ciprofloxacin hydrochloride?
The canonical SMILES is C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O.Cl.
What is the CAS number of ciprofloxacin hydrochloride?
The CAS number of ciprofloxacin hydrochloride is 93107-08-5.
What is the ChEMBL ID of ciprofloxacin hydrochloride?
The ChEMBL ID of ciprofloxacin hydrochloride is CHEMBL1202.
How does ciprofloxacin hydrochloride exert its bactericidal effect?
Ciprofloxacin hydrochloride exerts its bactericidal effect by interfering with the bacterial DNA gyrase, thereby inhibiting DNA synthesis and preventing bacterial cell growth.
What is the role of ciprofloxacin hydrochloride as an EC 5.99.1.3 inhibitor?
Ciprofloxacin hydrochloride has a role as an EC 5.99.1.3 inhibitor, specifically a DNA topoisomerase (ATP-hydrolysing) inhibitor.
What types of infections is ciprofloxacin hydrochloride approved for by the FDA?
Ciprofloxacin hydrochloride is approved by the FDA for the treatment and prevention of several infections caused by certain types of bacteria, such as certain urinary tract infections, lower respiratory tract infections, and skin infections.