What is the PubChem CID of p-Tolylsilane?
The PubChem CID of p-Tolylsilane is 6329193.
What is the molecular formula of p-Tolylsilane?
The molecular formula of p-Tolylsilane is C7H7Si.
What is the molecular weight of p-Tolylsilane?
The molecular weight of p-Tolylsilane is 119.22 g/mol.
Can you provide any synonyms for p-Tolylsilane?
Some synonyms for p-Tolylsilane include 931-70-4, 1-Methyl-4-silylbenzene, (4-Methylphenyl)silane, and Silane, (4-methylphenyl)-.
What is the InChI of p-Tolylsilane?
The InChI of p-Tolylsilane is InChI=1S/C7H7Si/c1-6-2-4-7(8)5-3-6/h2-5H,1H3.
What is the InChIKey of p-Tolylsilane?
The InChIKey of p-Tolylsilane is DDIXHFKHYMZDFP-UHFFFAOYSA-N.
What is the canonical SMILES of p-Tolylsilane?
The canonical SMILES of p-Tolylsilane is CC1=CC=C(C=C1)[Si].
What is the CAS number of p-Tolylsilane?
The CAS number of p-Tolylsilane is 931-70-4.
What is the hydrogen bond donor count of p-Tolylsilane?
The hydrogen bond donor count of p-Tolylsilane is 0.
Is p-Tolylsilane considered a canonical compound?
Yes, p-Tolylsilane is considered a canonical compound.