What is the PubChem CID of (R)-2-Aminocyclohenanol?
The PubChem CID of (R)-2-Aminocyclohenanol is 735777.
What is the molecular formula of (R)-2-Aminocyclohenanol?
The molecular formula of (R)-2-Aminocyclohenanol is C6H13NO.
What is the molecular weight of (R)-2-Aminocyclohenanol?
The molecular weight of (R)-2-Aminocyclohenanol is 115.17 g/mol.
What is the IUPAC name of (R)-2-Aminocyclohenanol?
The IUPAC name of (R)-2-Aminocyclohenanol is (1R,2R)-2-aminocyclohexan-1-ol.
What is the InChI of (R)-2-Aminocyclohenanol?
The InChI of (R)-2-Aminocyclohenanol is InChI=1S/C6H13NO/c7-5-3-1-2-4-6(5)8/h5-6,8H,1-4,7H2/t5-,6-/m1/s1.
What is the InChIKey of (R)-2-Aminocyclohenanol?
The InChIKey of (R)-2-Aminocyclohenanol is PQMCFTMVQORYJC-PHDIDXHHSA-N.
What is the canonical SMILES of (R)-2-Aminocyclohenanol?
The canonical SMILES of (R)-2-Aminocyclohenanol is C1CCC(C(C1)N)O.
How many CAS numbers are associated with (R)-2-Aminocyclohenanol?
(R)-2-Aminocyclohenanol is associated with two CAS numbers: 931-16-8 and 6982-39-4.
What is the European Community (EC) number of (R)-2-Aminocyclohenanol?
The European Community (EC) number of (R)-2-Aminocyclohenanol is 620-194-6.
Does (R)-2-Aminocyclohenanol have any defined atom stereocenters?
Yes, (R)-2-Aminocyclohenanol has two defined atom stereocenters.